C17H26BrClFN — CID 105400369
5-(4-bromo-5-chloro-2-fluorophenyl)-N-tert-butyl-3,3-dimethylpentan-1-amine (PubChem CID 105400369) has the molecular formula C17H26BrClFN and a molecular weight of 378.76 g/mol. Its IUPAC name is 5-(4-bromo-5-chloro-2-fluorophenyl)-N-tert-butyl-3,3-dimethylpentan-1-amine.
| Compound Name | 5-(4-bromo-5-chloro-2-fluorophenyl)-N-tert-butyl-3,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 105400369 |
| Molecular Formula | C17H26BrClFN |
| Molecular Weight | 378.76 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 5-(4-bromo-5-chloro-2-fluorophenyl)-N-tert-butyl-3,3-dimethylpentan-1-amine |
| SMILES | CC(C)(CCNC(C)(C)C)CCc1cc(Cl)c(Br)cc1F |
| InChI | InChI=1S/C17H26BrClFN/c1-16(2,3)21-9-8-17(4,5)7-6-12-10-14(19)13(18)11-15(12)20/h10-11,21H,6-9H2,1-5H3 |
| InChIKey | LIJCVPUQJLGYLJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.76 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|