C10H11F4N3O — CID 77032131
2-[2-fluoro-5-(trifluoromethyl)anilino]-N'-hydroxypropanimidamide (PubChem CID 77032131) has the molecular formula C10H11F4N3O and a molecular weight of 265.21 g/mol. Its IUPAC name is 2-[2-fluoro-5-(trifluoromethyl)anilino]-N'-hydroxypropanimidamide.
| Compound Name | 2-[2-fluoro-5-(trifluoromethyl)anilino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 77032131 |
| Molecular Formula | C10H11F4N3O |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-[2-fluoro-5-(trifluoromethyl)anilino]-N'-hydroxypropanimidamide |
| SMILES | CC(Nc1cc(C(F)(F)F)ccc1F)C(N)=NO |
| InChI | InChI=1S/C10H11F4N3O/c1-5(9(15)17-18)16-8-4-6(10(12,13)14)2-3-7(8)11/h2-5,16,18H,1H3,(H2,15,17) |
| InChIKey | UMEFSODEGIOTEF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|