C15H23N3O4 — CID 107243083
methyl 2-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]amino]butanoate (PubChem CID 107243083) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is methyl 2-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]amino]butanoate.
| Compound Name | methyl 2-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]amino]butanoate |
|---|---|
| PubChem CID | 107243083 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | methyl 2-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]amino]butanoate |
| SMILES | CCC(Nc1ccc(NC(=O)OC(C)(C)C)nc1)C(=O)OC |
| InChI | InChI=1S/C15H23N3O4/c1-6-11(13(19)21-5)17-10-7-8-12(16-9-10)18-14(20)22-15(2,3)4/h7-9,11,17H,6H2,1-5H3,(H,16,18,20) |
| InChIKey | UNQIGSAVLYIFJQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |