C20H28N4O2 — CID 113035609
tert-butyl N-[5-[4-(diethylamino)anilino]-2-pyridinyl]carbamate (PubChem CID 113035609) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is tert-butyl N-[5-[4-(diethylamino)anilino]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[4-(diethylamino)anilino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113035609 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | tert-butyl N-[5-[4-(diethylamino)anilino]-2-pyridinyl]carbamate |
| SMILES | CCN(CC)c1ccc(Nc2ccc(NC(=O)OC(C)(C)C)nc2)cc1 |
| InChI | InChI=1S/C20H28N4O2/c1-6-24(7-2)17-11-8-15(9-12-17)22-16-10-13-18(21-14-16)23-19(25)26-20(3,4)5/h8-14,22H,6-7H2,1-5H3,(H,21,23,25) |
| InChIKey | PQGQGBSXGYGCMO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|