C17H20BrN3O2 — CID 113036118
tert-butyl N-[5-(4-bromo-3-methylanilino)-2-pyridinyl]carbamate (PubChem CID 113036118) has the molecular formula C17H20BrN3O2 and a molecular weight of 378.27 g/mol. Its IUPAC name is tert-butyl N-[5-(4-bromo-3-methylanilino)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-(4-bromo-3-methylanilino)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113036118 |
| Molecular Formula | C17H20BrN3O2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | tert-butyl N-[5-(4-bromo-3-methylanilino)-2-pyridinyl]carbamate |
| SMILES | Cc1cc(Nc2ccc(NC(=O)OC(C)(C)C)nc2)ccc1Br |
| InChI | InChI=1S/C17H20BrN3O2/c1-11-9-12(5-7-14(11)18)20-13-6-8-15(19-10-13)21-16(22)23-17(2,3)4/h5-10,20H,1-4H3,(H,19,21,22) |
| InChIKey | CSOLIYFJAHWNOW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |