C15H18ClN3O2S — CID 103823865
tert-butyl N-[5-[(5-chlorothiophen-2-yl)methylamino]-2-pyridinyl]carbamate (PubChem CID 103823865) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is tert-butyl N-[5-[(5-chlorothiophen-2-yl)methylamino]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[(5-chlorothiophen-2-yl)methylamino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 103823865 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | tert-butyl N-[5-[(5-chlorothiophen-2-yl)methylamino]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(NCc2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C15H18ClN3O2S/c1-15(2,3)21-14(20)19-13-7-4-10(8-18-13)17-9-11-5-6-12(16)22-11/h4-8,17H,9H2,1-3H3,(H,18,19,20) |
| InChIKey | BTTOBMGBOBSTBN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |