C15H20N2O6 — CID 57303768
2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]methyl]butanedioic acid (PubChem CID 57303768) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]methyl]butanedioic acid.
| Compound Name | 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]methyl]butanedioic acid |
|---|---|
| PubChem CID | 57303768 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]methyl]butanedioic acid |
| SMILES | CC(C)(C)OC(=O)Nc1cc(CC(CC(=O)O)C(=O)O)ccn1 |
| InChI | InChI=1S/C15H20N2O6/c1-15(2,3)23-14(22)17-11-7-9(4-5-16-11)6-10(13(20)21)8-12(18)19/h4-5,7,10H,6,8H2,1-3H3,(H,18,19)(H,20,21)(H,16,17,22) |
| InChIKey | JFHBTDGCYYQUGE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |