C14H23N3O5S — CID 174445090
1-amino-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]butane-1-sulfonic acid (PubChem CID 174445090) has the molecular formula C14H23N3O5S and a molecular weight of 345.42 g/mol. Its IUPAC name is 1-amino-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]butane-1-sulfonic acid.
| Compound Name | 1-amino-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 174445090 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-amino-4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]butane-1-sulfonic acid |
| SMILES | CC(C)(C)OC(=O)Nc1cc(CCCC(N)S(=O)(=O)O)ccn1 |
| InChI | InChI=1S/C14H23N3O5S/c1-14(2,3)22-13(18)17-12-9-10(7-8-16-12)5-4-6-11(15)23(19,20)21/h7-9,11H,4-6,15H2,1-3H3,(H,16,17,18)(H,19,20,21) |
| InChIKey | MGKZPJKYURAHJL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|