C19H31FNO6P — CID 46867284
tert-butyl N-(3-diethoxyphosphoryl-3-fluoropropyl)-N-phenylmethoxycarbamate (PubChem CID 46867284) has the molecular formula C19H31FNO6P and a molecular weight of 419.43 g/mol. Its IUPAC name is tert-butyl N-(3-diethoxyphosphoryl-3-fluoropropyl)-N-phenylmethoxycarbamate.
| Compound Name | tert-butyl N-(3-diethoxyphosphoryl-3-fluoropropyl)-N-phenylmethoxycarbamate |
|---|---|
| PubChem CID | 46867284 |
| Molecular Formula | C19H31FNO6P |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | tert-butyl N-(3-diethoxyphosphoryl-3-fluoropropyl)-N-phenylmethoxycarbamate |
| SMILES | CCOP(=O)(OCC)C(F)CCN(OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H31FNO6P/c1-6-25-28(23,26-7-2)17(20)13-14-21(18(22)27-19(3,4)5)24-15-16-11-9-8-10-12-16/h8-12,17H,6-7,13-15H2,1-5H3 |
| InChIKey | RZVFLHSVIFFXDO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|