C27H37N3O6 — CID 46184080
tert-butyl N-benzyl-N-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]phenyl]methoxy]carbamate (PubChem CID 46184080) has the molecular formula C27H37N3O6 and a molecular weight of 499.61 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]phenyl]methoxy]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]phenyl]methoxy]carbamate |
|---|---|
| PubChem CID | 46184080 |
| Molecular Formula | C27H37N3O6 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | tert-butyl N-benzyl-N-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]phenyl]methoxy]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1ccc(CON(Cc2ccccc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H37N3O6/c1-26(2,3)35-24(32)29-17-16-28-23(31)22-14-12-21(13-15-22)19-34-30(25(33)36-27(4,5)6)18-20-10-8-7-9-11-20/h7-15H,16-19H2,1-6H3,(H,28,31)(H,29,32) |
| InChIKey | BEVZGHQUZSUBGI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|