C20H28NO5PS — CID 16664922
N-(3-diethoxyphosphoryl-3-thiophen-2-ylpropyl)-N-phenylmethoxyacetamide (PubChem CID 16664922) has the molecular formula C20H28NO5PS and a molecular weight of 425.49 g/mol. Its IUPAC name is N-(3-diethoxyphosphoryl-3-thiophen-2-ylpropyl)-N-phenylmethoxyacetamide.
| Compound Name | N-(3-diethoxyphosphoryl-3-thiophen-2-ylpropyl)-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 16664922 |
| Molecular Formula | C20H28NO5PS |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-(3-diethoxyphosphoryl-3-thiophen-2-ylpropyl)-N-phenylmethoxyacetamide |
| SMILES | CCOP(=O)(OCC)C(CCN(OCc1ccccc1)C(C)=O)c1cccs1 |
| InChI | InChI=1S/C20H28NO5PS/c1-4-25-27(23,26-5-2)19(20-12-9-15-28-20)13-14-21(17(3)22)24-16-18-10-7-6-8-11-18/h6-12,15,19H,4-5,13-14,16H2,1-3H3 |
| InChIKey | OMLTZKWFIPIISM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|