C28H31N4O5P — CID 71546039
N-[3-bis(phenylmethoxy)phosphoryl-3-(triazol-1-yl)propyl]-N-phenylmethoxyacetamide (PubChem CID 71546039) has the molecular formula C28H31N4O5P and a molecular weight of 534.55 g/mol. Its IUPAC name is N-[3-bis(phenylmethoxy)phosphoryl-3-(triazol-1-yl)propyl]-N-phenylmethoxyacetamide.
| Compound Name | N-[3-bis(phenylmethoxy)phosphoryl-3-(triazol-1-yl)propyl]-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 71546039 |
| Molecular Formula | C28H31N4O5P |
| Molecular Weight | 534.55 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | N-[3-bis(phenylmethoxy)phosphoryl-3-(triazol-1-yl)propyl]-N-phenylmethoxyacetamide |
| SMILES | CC(=O)N(CCC(n1ccnn1)P(=O)(OCc1ccccc1)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C28H31N4O5P/c1-24(33)32(35-21-25-11-5-2-6-12-25)19-17-28(31-20-18-29-30-31)38(34,36-22-26-13-7-3-8-14-26)37-23-27-15-9-4-10-16-27/h2-16,18,20,28H,17,19,21-23H2,1H3 |
| InChIKey | IDBHGLCEFMNANX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|