C20H24Cl2NO3P — CID 174340138
N-[3-(3,4-dichlorophenyl)-3-dimethylphosphorylpropyl]-N-phenylmethoxyacetamide (PubChem CID 174340138) has the molecular formula C20H24Cl2NO3P and a molecular weight of 428.30 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)-3-dimethylphosphorylpropyl]-N-phenylmethoxyacetamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)-3-dimethylphosphorylpropyl]-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 174340138 |
| Molecular Formula | C20H24Cl2NO3P |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)-3-dimethylphosphorylpropyl]-N-phenylmethoxyacetamide |
| SMILES | CC(=O)N(CCC(c1ccc(Cl)c(Cl)c1)P(C)(C)=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H24Cl2NO3P/c1-15(24)23(26-14-16-7-5-4-6-8-16)12-11-20(27(2,3)25)17-9-10-18(21)19(22)13-17/h4-10,13,20H,11-12,14H2,1-3H3 |
| InChIKey | HXOIMNXAIHUWOV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|