C16H16Cl2NO4P — CID 154512121
[1-(3,4-dichlorophenyl)-3-phenylmethoxyiminopropyl]phosphonic acid (PubChem CID 154512121) has the molecular formula C16H16Cl2NO4P and a molecular weight of 388.19 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)-3-phenylmethoxyiminopropyl]phosphonic acid.
| Compound Name | [1-(3,4-dichlorophenyl)-3-phenylmethoxyiminopropyl]phosphonic acid |
|---|---|
| PubChem CID | 154512121 |
| Molecular Formula | C16H16Cl2NO4P |
| Molecular Weight | 388.19 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | [1-(3,4-dichlorophenyl)-3-phenylmethoxyiminopropyl]phosphonic acid |
| SMILES | O=P(O)(O)C(CC=NOCc1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2NO4P/c17-14-7-6-13(10-15(14)18)16(24(20,21)22)8-9-19-23-11-12-4-2-1-3-5-12/h1-7,9-10,16H,8,11H2,(H2,20,21,22) |
| InChIKey | LMXJLSPCZHTFOX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.19 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|