C7H8Cl2NO3P — CID 11086348
[(R)-amino-(3,4-dichlorophenyl)methyl]phosphonic acid (PubChem CID 11086348) has the molecular formula C7H8Cl2NO3P and a molecular weight of 256.03 g/mol. Its IUPAC name is [(R)-amino-(3,4-dichlorophenyl)methyl]phosphonic acid.
| Compound Name | [(R)-amino-(3,4-dichlorophenyl)methyl]phosphonic acid |
|---|---|
| PubChem CID | 11086348 |
| Molecular Formula | C7H8Cl2NO3P |
| Molecular Weight | 256.03 g/mol |
| Exact Mass | 254.96 |
| IUPAC Name | [(R)-amino-(3,4-dichlorophenyl)methyl]phosphonic acid |
| SMILES | N[C@@H](c1ccc(Cl)c(Cl)c1)P(=O)(O)O |
| InChI | InChI=1S/C7H8Cl2NO3P/c8-5-2-1-4(3-6(5)9)7(10)14(11,12)13/h1-3,7H,10H2,(H2,11,12,13)/t7-/m1/s1 |
| InChIKey | BDTAUBLQGHLEIO-SSDOTTSWSA-N |
| XLogP | 2.13 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.03 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|