C8H11N2O5P — CID 4830676
[amino-(4-methyl-3-nitrophenyl)methyl]phosphonic acid (PubChem CID 4830676) has the molecular formula C8H11N2O5P and a molecular weight of 246.16 g/mol. Its IUPAC name is [amino-(4-methyl-3-nitrophenyl)methyl]phosphonic acid.
| Compound Name | [amino-(4-methyl-3-nitrophenyl)methyl]phosphonic acid |
|---|---|
| PubChem CID | 4830676 |
| Molecular Formula | C8H11N2O5P |
| Molecular Weight | 246.16 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | [amino-(4-methyl-3-nitrophenyl)methyl]phosphonic acid |
| SMILES | Cc1ccc(C(N)P(=O)(O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11N2O5P/c1-5-2-3-6(4-7(5)10(11)12)8(9)16(13,14)15/h2-4,8H,9H2,1H3,(H2,13,14,15) |
| InChIKey | DQYCDZNZYYPHFZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.16 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|