C8H10N2O5P- — CID 2445301
[(R)-(4-methyl-3-nitrophenyl)-phosphonatomethyl]azanium (PubChem CID 2445301) has the molecular formula C8H10N2O5P- and a molecular weight of 245.15 g/mol. Its IUPAC name is [(R)-(4-methyl-3-nitrophenyl)-phosphonatomethyl]azanium.
| Compound Name | [(R)-(4-methyl-3-nitrophenyl)-phosphonatomethyl]azanium |
|---|---|
| PubChem CID | 2445301 |
| Molecular Formula | C8H10N2O5P- |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | [(R)-(4-methyl-3-nitrophenyl)-phosphonatomethyl]azanium |
| SMILES | Cc1ccc([C@H]([NH3+])P(=O)([O-])[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11N2O5P/c1-5-2-3-6(4-7(5)10(11)12)8(9)16(13,14)15/h2-4,8H,9H2,1H3,(H2,13,14,15)/p-1/t8-/m1/s1 |
| InChIKey | DQYCDZNZYYPHFZ-MRVPVSSYSA-M |
| XLogP | -0.94 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|