C9H10Cl2NO5PS — CID 72711518
[(3,4-dichlorophenyl)-[2-(hydroxyamino)-2-oxoethyl]sulfanylmethyl]phosphonic acid (PubChem CID 72711518) has the molecular formula C9H10Cl2NO5PS and a molecular weight of 346.13 g/mol. Its IUPAC name is [(3,4-dichlorophenyl)-[2-(hydroxyamino)-2-oxoethyl]sulfanylmethyl]phosphonic acid.
| Compound Name | [(3,4-dichlorophenyl)-[2-(hydroxyamino)-2-oxoethyl]sulfanylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 72711518 |
| Molecular Formula | C9H10Cl2NO5PS |
| Molecular Weight | 346.13 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | [(3,4-dichlorophenyl)-[2-(hydroxyamino)-2-oxoethyl]sulfanylmethyl]phosphonic acid |
| SMILES | O=C(CSC(c1ccc(Cl)c(Cl)c1)P(=O)(O)O)NO |
| InChI | InChI=1S/C9H10Cl2NO5PS/c10-6-2-1-5(3-7(6)11)9(18(15,16)17)19-4-8(13)12-14/h1-3,9,14H,4H2,(H,12,13)(H2,15,16,17) |
| InChIKey | MMODIMKCMBCKCF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.13 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|