C10H12Cl2NO5P — CID 15949469
[1-(3,4-dichlorophenyl)-3-[formyl(hydroxy)amino]propyl]phosphonic acid (PubChem CID 15949469) has the molecular formula C10H12Cl2NO5P and a molecular weight of 328.09 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)-3-[formyl(hydroxy)amino]propyl]phosphonic acid.
| Compound Name | [1-(3,4-dichlorophenyl)-3-[formyl(hydroxy)amino]propyl]phosphonic acid |
|---|---|
| PubChem CID | 15949469 |
| Molecular Formula | C10H12Cl2NO5P |
| Molecular Weight | 328.09 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | [1-(3,4-dichlorophenyl)-3-[formyl(hydroxy)amino]propyl]phosphonic acid |
| SMILES | O=CN(O)CCC(c1ccc(Cl)c(Cl)c1)P(=O)(O)O |
| InChI | InChI=1S/C10H12Cl2NO5P/c11-8-2-1-7(5-9(8)12)10(19(16,17)18)3-4-13(15)6-14/h1-2,5-6,10,15H,3-4H2,(H2,16,17,18) |
| InChIKey | AJGPMMOCRYQLNY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.09 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|