C12H14Cl2N2 — CID 82089128
2-(3,4-dichlorophenyl)-4-(dimethylamino)butanenitrile (PubChem CID 82089128) has the molecular formula C12H14Cl2N2 and a molecular weight of 257.16 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4-(dimethylamino)butanenitrile.
| Compound Name | 2-(3,4-dichlorophenyl)-4-(dimethylamino)butanenitrile |
|---|---|
| PubChem CID | 82089128 |
| Molecular Formula | C12H14Cl2N2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4-(dimethylamino)butanenitrile |
| SMILES | CN(C)CCC(C#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2/c1-16(2)6-5-10(8-15)9-3-4-11(13)12(14)7-9/h3-4,7,10H,5-6H2,1-2H3 |
| InChIKey | LQDYOLVDBQGEKB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |