C12H9Cl2NO2 — CID 141005164
2-(3,4-dichlorophenyl)-3-(1,3-dioxol-2-yl)propanenitrile (PubChem CID 141005164) has the molecular formula C12H9Cl2NO2 and a molecular weight of 270.12 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-3-(1,3-dioxol-2-yl)propanenitrile.
| Compound Name | 2-(3,4-dichlorophenyl)-3-(1,3-dioxol-2-yl)propanenitrile |
|---|---|
| PubChem CID | 141005164 |
| Molecular Formula | C12H9Cl2NO2 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-3-(1,3-dioxol-2-yl)propanenitrile |
| SMILES | N#CC(CC1OC=CO1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H9Cl2NO2/c13-10-2-1-8(5-11(10)14)9(7-15)6-12-16-3-4-17-12/h1-5,9,12H,6H2 |
| InChIKey | JTLHFKXAUNXBMG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |