C16H20Cl2N2 — CID 57236753
2-(3,4-dichlorophenyl)-4-hexyliminobutanenitrile (PubChem CID 57236753) has the molecular formula C16H20Cl2N2 and a molecular weight of 311.26 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4-hexyliminobutanenitrile.
| Compound Name | 2-(3,4-dichlorophenyl)-4-hexyliminobutanenitrile |
|---|---|
| PubChem CID | 57236753 |
| Molecular Formula | C16H20Cl2N2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4-hexyliminobutanenitrile |
| SMILES | CCCCCC/N=C/CC(C#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H20Cl2N2/c1-2-3-4-5-9-20-10-8-14(12-19)13-6-7-15(17)16(18)11-13/h6-7,10-11,14H,2-5,8-9H2,1H3/b20-10+ |
| InChIKey | BXNLEOFDJYZSDF-KEBDBYFISA-N |
| XLogP | 5.64 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|