C15H21Cl3 — CID 55223341
1,2-dichloro-4-(2-chlorononyl)benzene (PubChem CID 55223341) has the molecular formula C15H21Cl3 and a molecular weight of 307.69 g/mol. Its IUPAC name is 1,2-dichloro-4-(2-chlorononyl)benzene.
| Compound Name | 1,2-dichloro-4-(2-chlorononyl)benzene |
|---|---|
| PubChem CID | 55223341 |
| Molecular Formula | C15H21Cl3 |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1,2-dichloro-4-(2-chlorononyl)benzene |
| SMILES | CCCCCCCC(Cl)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H21Cl3/c1-2-3-4-5-6-7-13(16)10-12-8-9-14(17)15(18)11-12/h8-9,11,13H,2-7,10H2,1H3 |
| InChIKey | FTRCMPXYXGPVJL-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|