C23H28Cl4N2 — CID 87925102
1,5-bis(3,4-dichlorophenyl)-3-hexyliminopentan-2-amine (PubChem CID 87925102) has the molecular formula C23H28Cl4N2 and a molecular weight of 474.30 g/mol. Its IUPAC name is 1,5-bis(3,4-dichlorophenyl)-3-hexyliminopentan-2-amine.
| Compound Name | 1,5-bis(3,4-dichlorophenyl)-3-hexyliminopentan-2-amine |
|---|---|
| PubChem CID | 87925102 |
| Molecular Formula | C23H28Cl4N2 |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 1,5-bis(3,4-dichlorophenyl)-3-hexyliminopentan-2-amine |
| SMILES | CCCCCC/N=C(\CCc1ccc(Cl)c(Cl)c1)C(N)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H28Cl4N2/c1-2-3-4-5-12-29-23(11-8-16-6-9-18(24)20(26)13-16)22(28)15-17-7-10-19(25)21(27)14-17/h6-7,9-10,13-14,22H,2-5,8,11-12,15,28H2,1H3/b29-23+ |
| InChIKey | KFNYUTPXVMXYTE-BYNJWEBRSA-N |
| XLogP | 7.82 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|