C13H17Cl3 — CID 64516622
1,2-dichloro-4-(4-chloroheptyl)benzene (PubChem CID 64516622) has the molecular formula C13H17Cl3 and a molecular weight of 279.64 g/mol. Its IUPAC name is 1,2-dichloro-4-(4-chloroheptyl)benzene.
| Compound Name | 1,2-dichloro-4-(4-chloroheptyl)benzene |
|---|---|
| PubChem CID | 64516622 |
| Molecular Formula | C13H17Cl3 |
| Molecular Weight | 279.64 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 1,2-dichloro-4-(4-chloroheptyl)benzene |
| SMILES | CCCC(Cl)CCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl3/c1-2-4-11(14)6-3-5-10-7-8-12(15)13(16)9-10/h7-9,11H,2-6H2,1H3 |
| InChIKey | VLEPXHRFNFGYIA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|