C16H20Cl2N2 — CID 19909380
4-(azepan-1-yl)-2-(3,4-dichlorophenyl)butanenitrile (PubChem CID 19909380) has the molecular formula C16H20Cl2N2 and a molecular weight of 311.26 g/mol. Its IUPAC name is 4-(azepan-1-yl)-2-(3,4-dichlorophenyl)butanenitrile.
| Compound Name | 4-(azepan-1-yl)-2-(3,4-dichlorophenyl)butanenitrile |
|---|---|
| PubChem CID | 19909380 |
| Molecular Formula | C16H20Cl2N2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-(azepan-1-yl)-2-(3,4-dichlorophenyl)butanenitrile |
| SMILES | N#CC(CCN1CCCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H20Cl2N2/c17-15-6-5-13(11-16(15)18)14(12-19)7-10-20-8-3-1-2-4-9-20/h5-6,11,14H,1-4,7-10H2 |
| InChIKey | FDBRAWBRRXMTNH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |