C18H18Cl2NO7P — CID 71818539
[3-[(3-acetyloxybenzoyl)-hydroxyamino]-1-(3,4-dichlorophenyl)propyl]phosphonic acid (PubChem CID 71818539) has the molecular formula C18H18Cl2NO7P and a molecular weight of 462.22 g/mol. Its IUPAC name is [3-[(3-acetyloxybenzoyl)-hydroxyamino]-1-(3,4-dichlorophenyl)propyl]phosphonic acid.
| Compound Name | [3-[(3-acetyloxybenzoyl)-hydroxyamino]-1-(3,4-dichlorophenyl)propyl]phosphonic acid |
|---|---|
| PubChem CID | 71818539 |
| Molecular Formula | C18H18Cl2NO7P |
| Molecular Weight | 462.22 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | [3-[(3-acetyloxybenzoyl)-hydroxyamino]-1-(3,4-dichlorophenyl)propyl]phosphonic acid |
| SMILES | CC(=O)Oc1cccc(C(=O)N(O)CCC(c2ccc(Cl)c(Cl)c2)P(=O)(O)O)c1 |
| InChI | InChI=1S/C18H18Cl2NO7P/c1-11(22)28-14-4-2-3-13(9-14)18(23)21(24)8-7-17(29(25,26)27)12-5-6-15(19)16(20)10-12/h2-6,9-10,17,24H,7-8H2,1H3,(H2,25,26,27) |
| InChIKey | FUNSHBDZLXZYFW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.22 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|