C7H9ClNO3P — CID 101067310
[(S)-amino-(2-chlorophenyl)methyl]phosphonic acid (PubChem CID 101067310) has the molecular formula C7H9ClNO3P and a molecular weight of 221.58 g/mol. Its IUPAC name is [(S)-amino-(2-chlorophenyl)methyl]phosphonic acid.
| Compound Name | [(S)-amino-(2-chlorophenyl)methyl]phosphonic acid |
|---|---|
| PubChem CID | 101067310 |
| Molecular Formula | C7H9ClNO3P |
| Molecular Weight | 221.58 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | [(S)-amino-(2-chlorophenyl)methyl]phosphonic acid |
| SMILES | N[C@H](c1ccccc1Cl)P(=O)(O)O |
| InChI | InChI=1S/C7H9ClNO3P/c8-6-4-2-1-3-5(6)7(9)13(10,11)12/h1-4,7H,9H2,(H2,10,11,12)/t7-/m0/s1 |
| InChIKey | HPVJMDWKOFMDCY-ZETCQYMHSA-N |
| XLogP | 1.48 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.58 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|