C8H12Cl2NO3P — CID 142688208
[2-amino-1-(2-chlorophenyl)ethyl]phosphonic acid;hydrochloride (PubChem CID 142688208) has the molecular formula C8H12Cl2NO3P and a molecular weight of 272.07 g/mol. Its IUPAC name is [2-amino-1-(2-chlorophenyl)ethyl]phosphonic acid;hydrochloride.
| Compound Name | [2-amino-1-(2-chlorophenyl)ethyl]phosphonic acid;hydrochloride |
|---|---|
| PubChem CID | 142688208 |
| Molecular Formula | C8H12Cl2NO3P |
| Molecular Weight | 272.07 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | [2-amino-1-(2-chlorophenyl)ethyl]phosphonic acid;hydrochloride |
| SMILES | Cl.NCC(c1ccccc1Cl)P(=O)(O)O |
| InChI | InChI=1S/C8H11ClNO3P.ClH/c9-7-4-2-1-3-6(7)8(5-10)14(11,12)13;/h1-4,8H,5,10H2,(H2,11,12,13);1H |
| InChIKey | ZWEZUDUXHRVZEU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.07 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|