C11H13ClN2O2 — CID 13034531
3-(2-chlorophenyl)pentanediamide (PubChem CID 13034531) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 3-(2-chlorophenyl)pentanediamide.
| Compound Name | 3-(2-chlorophenyl)pentanediamide |
|---|---|
| PubChem CID | 13034531 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 3-(2-chlorophenyl)pentanediamide |
| SMILES | NC(=O)CC(CC(N)=O)c1ccccc1Cl |
| InChI | InChI=1S/C11H13ClN2O2/c12-9-4-2-1-3-8(9)7(5-10(13)15)6-11(14)16/h1-4,7H,5-6H2,(H2,13,15)(H2,14,16) |
| InChIKey | BFOBNJFJPNXQIU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |