C11H14ClNO3 — CID 174774368
[2-(2-chlorophenyl)-3-hydroxybutyl] carbamate (PubChem CID 174774368) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-3-hydroxybutyl] carbamate.
| Compound Name | [2-(2-chlorophenyl)-3-hydroxybutyl] carbamate |
|---|---|
| PubChem CID | 174774368 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | [2-(2-chlorophenyl)-3-hydroxybutyl] carbamate |
| SMILES | CC(O)C(COC(N)=O)c1ccccc1Cl |
| InChI | InChI=1S/C11H14ClNO3/c1-7(14)9(6-16-11(13)15)8-4-2-3-5-10(8)12/h2-5,7,9,14H,6H2,1H3,(H2,13,15) |
| InChIKey | YIVLZFBJTRNIGV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |