C17H20Cl2NOP — CID 166076955
3-(3,4-dichlorophenyl)-N-methyl-N-phenylmethoxy-3-phosphanylpropan-1-amine (PubChem CID 166076955) has the molecular formula C17H20Cl2NOP and a molecular weight of 356.23 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-methyl-N-phenylmethoxy-3-phosphanylpropan-1-amine.
| Compound Name | 3-(3,4-dichlorophenyl)-N-methyl-N-phenylmethoxy-3-phosphanylpropan-1-amine |
|---|---|
| PubChem CID | 166076955 |
| Molecular Formula | C17H20Cl2NOP |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-methyl-N-phenylmethoxy-3-phosphanylpropan-1-amine |
| SMILES | CN(CCC(P)c1ccc(Cl)c(Cl)c1)OCc1ccccc1 |
| InChI | InChI=1S/C17H20Cl2NOP/c1-20(21-12-13-5-3-2-4-6-13)10-9-17(22)14-7-8-15(18)16(19)11-14/h2-8,11,17H,9-10,12,22H2,1H3 |
| InChIKey | DPBLUTXCWIWHLQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|