C17H21O4PS2 — CID 132500067
(E)-5-diethoxyphosphoryl-1,5-dithiophen-2-ylpent-1-en-3-one (PubChem CID 132500067) has the molecular formula C17H21O4PS2 and a molecular weight of 384.46 g/mol. Its IUPAC name is (E)-5-diethoxyphosphoryl-1,5-dithiophen-2-ylpent-1-en-3-one.
| Compound Name | (E)-5-diethoxyphosphoryl-1,5-dithiophen-2-ylpent-1-en-3-one |
|---|---|
| PubChem CID | 132500067 |
| Molecular Formula | C17H21O4PS2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | (E)-5-diethoxyphosphoryl-1,5-dithiophen-2-ylpent-1-en-3-one |
| SMILES | CCOP(=O)(OCC)C(CC(=O)/C=C/c1cccs1)c1cccs1 |
| InChI | InChI=1S/C17H21O4PS2/c1-3-20-22(19,21-4-2)16(17-8-6-12-24-17)13-14(18)9-10-15-7-5-11-23-15/h5-12,16H,3-4,13H2,1-2H3/b10-9+ |
| InChIKey | JYPYIYXFLUYGPY-MDZDMXLPSA-N |
| XLogP | 5.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|