C16H22NO4P — CID 15877643
5-(1-diethoxyphosphoryl-2-phenylethyl)-3-methyl-1,2-oxazole (PubChem CID 15877643) has the molecular formula C16H22NO4P and a molecular weight of 323.33 g/mol. Its IUPAC name is 5-(1-diethoxyphosphoryl-2-phenylethyl)-3-methyl-1,2-oxazole.
| Compound Name | 5-(1-diethoxyphosphoryl-2-phenylethyl)-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 15877643 |
| Molecular Formula | C16H22NO4P |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 5-(1-diethoxyphosphoryl-2-phenylethyl)-3-methyl-1,2-oxazole |
| SMILES | CCOP(=O)(OCC)C(Cc1ccccc1)c1cc(C)no1 |
| InChI | InChI=1S/C16H22NO4P/c1-4-19-22(18,20-5-2)16(15-11-13(3)17-21-15)12-14-9-7-6-8-10-14/h6-11,16H,4-5,12H2,1-3H3 |
| InChIKey | MFCFKBOSIJRGEU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|