C21H23Cl2O3PS — CID 24948039
2-[2-(3,4-dichlorophenyl)-1-diethoxyphosphorylethyl]-3-methyl-1-benzothiophene (PubChem CID 24948039) has the molecular formula C21H23Cl2O3PS and a molecular weight of 457.36 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)-1-diethoxyphosphorylethyl]-3-methyl-1-benzothiophene.
| Compound Name | 2-[2-(3,4-dichlorophenyl)-1-diethoxyphosphorylethyl]-3-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 24948039 |
| Molecular Formula | C21H23Cl2O3PS |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)-1-diethoxyphosphorylethyl]-3-methyl-1-benzothiophene |
| SMILES | CCOP(=O)(OCC)C(Cc1ccc(Cl)c(Cl)c1)c1sc2ccccc2c1C |
| InChI | InChI=1S/C21H23Cl2O3PS/c1-4-25-27(24,26-5-2)19(13-15-10-11-17(22)18(23)12-15)21-14(3)16-8-6-7-9-20(16)28-21/h6-12,19H,4-5,13H2,1-3H3 |
| InChIKey | PXZQZBFZSFAGOJ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|