C22H25ClFO3PS — CID 24946404
2-[2-(6-chloro-2-fluoro-3-methylphenyl)-1-diethoxyphosphorylethyl]-3-methyl-1-benzothiophene (PubChem CID 24946404) has the molecular formula C22H25ClFO3PS and a molecular weight of 454.93 g/mol. Its IUPAC name is 2-[2-(6-chloro-2-fluoro-3-methylphenyl)-1-diethoxyphosphorylethyl]-3-methyl-1-benzothiophene.
| Compound Name | 2-[2-(6-chloro-2-fluoro-3-methylphenyl)-1-diethoxyphosphorylethyl]-3-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 24946404 |
| Molecular Formula | C22H25ClFO3PS |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 2-[2-(6-chloro-2-fluoro-3-methylphenyl)-1-diethoxyphosphorylethyl]-3-methyl-1-benzothiophene |
| SMILES | CCOP(=O)(OCC)C(Cc1c(Cl)ccc(C)c1F)c1sc2ccccc2c1C |
| InChI | InChI=1S/C22H25ClFO3PS/c1-5-26-28(25,27-6-2)19(13-17-18(23)12-11-14(3)21(17)24)22-15(4)16-9-7-8-10-20(16)29-22/h7-12,19H,5-6,13H2,1-4H3 |
| InChIKey | FOAVWEMCRKYYHU-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|