C12H18ClFNO3P — CID 171191856
(S)-(6-chloro-2-fluoro-3-methylphenyl)-diethoxyphosphorylmethanamine (PubChem CID 171191856) has the molecular formula C12H18ClFNO3P and a molecular weight of 309.71 g/mol. Its IUPAC name is (S)-(6-chloro-2-fluoro-3-methylphenyl)-diethoxyphosphorylmethanamine.
| Compound Name | (S)-(6-chloro-2-fluoro-3-methylphenyl)-diethoxyphosphorylmethanamine |
|---|---|
| PubChem CID | 171191856 |
| Molecular Formula | C12H18ClFNO3P |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | (S)-(6-chloro-2-fluoro-3-methylphenyl)-diethoxyphosphorylmethanamine |
| SMILES | CCOP(=O)(OCC)[C@H](N)c1c(Cl)ccc(C)c1F |
| InChI | InChI=1S/C12H18ClFNO3P/c1-4-17-19(16,18-5-2)12(15)10-9(13)7-6-8(3)11(10)14/h6-7,12H,4-5,15H2,1-3H3/t12-/m0/s1 |
| InChIKey | KEAGRKGWIBJBDH-LBPRGKRZSA-N |
| XLogP | 4.01 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|