C20H29N2O6P — CID 10410087
tert-butyl N-[(Z)-4-cyano-4-diethoxyphosphoryl-3-hydroxy-1-phenylbut-3-en-2-yl]carbamate (PubChem CID 10410087) has the molecular formula C20H29N2O6P and a molecular weight of 424.43 g/mol. Its IUPAC name is tert-butyl N-[(Z)-4-cyano-4-diethoxyphosphoryl-3-hydroxy-1-phenylbut-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(Z)-4-cyano-4-diethoxyphosphoryl-3-hydroxy-1-phenylbut-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 10410087 |
| Molecular Formula | C20H29N2O6P |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | tert-butyl N-[(Z)-4-cyano-4-diethoxyphosphoryl-3-hydroxy-1-phenylbut-3-en-2-yl]carbamate |
| SMILES | CCOP(=O)(OCC)/C(C#N)=C(\O)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29N2O6P/c1-6-26-29(25,27-7-2)17(14-21)18(23)16(13-15-11-9-8-10-12-15)22-19(24)28-20(3,4)5/h8-12,16,23H,6-7,13H2,1-5H3,(H,22,24)/b18-17- |
| InChIKey | LEMFBKPGYZWMEA-ZCXUNETKSA-N |
| XLogP | 4.68 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|