C25H30ClNO4 — CID 59608250
ethyl (E,4R)-5-[4-(3-chlorophenyl)phenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate (PubChem CID 59608250) has the molecular formula C25H30ClNO4 and a molecular weight of 443.97 g/mol. Its IUPAC name is ethyl (E,4R)-5-[4-(3-chlorophenyl)phenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate.
| Compound Name | ethyl (E,4R)-5-[4-(3-chlorophenyl)phenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate |
|---|---|
| PubChem CID | 59608250 |
| Molecular Formula | C25H30ClNO4 |
| Molecular Weight | 443.97 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | ethyl (E,4R)-5-[4-(3-chlorophenyl)phenyl]-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pent-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](Cc1ccc(-c2cccc(Cl)c2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H30ClNO4/c1-6-30-23(28)17(2)14-22(27-24(29)31-25(3,4)5)15-18-10-12-19(13-11-18)20-8-7-9-21(26)16-20/h7-14,16,22H,6,15H2,1-5H3,(H,27,29)/b17-14+/t22-/m0/s1 |
| InChIKey | GCXVIHSPMVTNLQ-QMPJNXRZSA-N |
| XLogP | 5.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.97 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|