C22H25NO3 — CID 160743085
ethyl (E,4R)-4-acetamido-2-methyl-5-(4-phenylphenyl)pent-2-enoate (PubChem CID 160743085) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is ethyl (E,4R)-4-acetamido-2-methyl-5-(4-phenylphenyl)pent-2-enoate.
| Compound Name | ethyl (E,4R)-4-acetamido-2-methyl-5-(4-phenylphenyl)pent-2-enoate |
|---|---|
| PubChem CID | 160743085 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | ethyl (E,4R)-4-acetamido-2-methyl-5-(4-phenylphenyl)pent-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(C)=O |
| InChI | InChI=1S/C22H25NO3/c1-4-26-22(25)16(2)14-21(23-17(3)24)15-18-10-12-20(13-11-18)19-8-6-5-7-9-19/h5-14,21H,4,15H2,1-3H3,(H,23,24)/b16-14+/t21-/m0/s1 |
| InChIKey | RIIJHMPIHZGOGE-OZIPEELISA-N |
| XLogP | 3.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|