C24H27N3O3 — CID 139888213
pyrimidin-5-ylmethyl N-(3-hydroxy-1,6-diphenylhexyl)carbamate (PubChem CID 139888213) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is pyrimidin-5-ylmethyl N-(3-hydroxy-1,6-diphenylhexyl)carbamate.
| Compound Name | pyrimidin-5-ylmethyl N-(3-hydroxy-1,6-diphenylhexyl)carbamate |
|---|---|
| PubChem CID | 139888213 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | pyrimidin-5-ylmethyl N-(3-hydroxy-1,6-diphenylhexyl)carbamate |
| SMILES | O=C(NC(CC(O)CCCc1ccccc1)c1ccccc1)OCc1cncnc1 |
| InChI | InChI=1S/C24H27N3O3/c28-22(13-7-10-19-8-3-1-4-9-19)14-23(21-11-5-2-6-12-21)27-24(29)30-17-20-15-25-18-26-16-20/h1-6,8-9,11-12,15-16,18,22-23,28H,7,10,13-14,17H2,(H,27,29) |
| InChIKey | ASPIUHFKQVWGHU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |