C21H30N2O8 — CID 10575007
methyl (2R,3R)-4-acetyloxy-2-[acetyloxy(benzyl)amino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 10575007) has the molecular formula C21H30N2O8 and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl (2R,3R)-4-acetyloxy-2-[acetyloxy(benzyl)amino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl (2R,3R)-4-acetyloxy-2-[acetyloxy(benzyl)amino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 10575007 |
| Molecular Formula | C21H30N2O8 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | methyl (2R,3R)-4-acetyloxy-2-[acetyloxy(benzyl)amino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COC(=O)[C@@H]([C@H](COC(C)=O)NC(=O)OC(C)(C)C)N(Cc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C21H30N2O8/c1-14(24)29-13-17(22-20(27)30-21(3,4)5)18(19(26)28-6)23(31-15(2)25)12-16-10-8-7-9-11-16/h7-11,17-18H,12-13H2,1-6H3,(H,22,27)/t17-,18+/m0/s1 |
| InChIKey | ZUZGTESGHJCXMQ-ZWKOTPCHSA-N |
| XLogP | 1.96 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|