C24H35NO6 — CID 11059124
tert-butyl (E,4S,5R)-4-acetyloxy-3-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhex-2-enoate (PubChem CID 11059124) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl (E,4S,5R)-4-acetyloxy-3-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhex-2-enoate.
| Compound Name | tert-butyl (E,4S,5R)-4-acetyloxy-3-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhex-2-enoate |
|---|---|
| PubChem CID | 11059124 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | tert-butyl (E,4S,5R)-4-acetyloxy-3-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylhex-2-enoate |
| SMILES | CC(=O)O[C@@H](/C(C)=C/C(=O)OC(C)(C)C)[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H35NO6/c1-16(14-20(27)30-23(3,4)5)21(29-17(2)26)19(15-18-12-10-9-11-13-18)25-22(28)31-24(6,7)8/h9-14,19,21H,15H2,1-8H3,(H,25,28)/b16-14+/t19-,21+/m1/s1 |
| InChIKey | DNTDYMANAGTFPT-ODKDEZGZSA-N |
| XLogP | 4.34 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|