C17H23NO8 — CID 157273392
[(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxo-4-phenylbutan-2-yl] acetate;ozone (PubChem CID 157273392) has the molecular formula C17H23NO8 and a molecular weight of 369.37 g/mol. Its IUPAC name is [(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxo-4-phenylbutan-2-yl] acetate;ozone.
| Compound Name | [(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxo-4-phenylbutan-2-yl] acetate;ozone |
|---|---|
| PubChem CID | 157273392 |
| Molecular Formula | C17H23NO8 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxo-4-phenylbutan-2-yl] acetate;ozone |
| SMILES | CC(=O)O[C@@H](C=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C.O=[O+][O-] |
| InChI | InChI=1S/C17H23NO5.O3/c1-12(20)22-15(11-19)14(10-13-8-6-5-7-9-13)18-16(21)23-17(2,3)4;1-3-2/h5-9,11,14-15H,10H2,1-4H3,(H,18,21);/t14-,15-;/m0./s1 |
| InChIKey | AYUMEMIEIWSDCN-YYLIZZNMSA-N |
| XLogP | 1.13 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|