C14H20F2N2O2 — CID 130316482
benzyl N-[(2R)-1-amino-3,3-difluorohexan-2-yl]carbamate (PubChem CID 130316482) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is benzyl N-[(2R)-1-amino-3,3-difluorohexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-amino-3,3-difluorohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 130316482 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | benzyl N-[(2R)-1-amino-3,3-difluorohexan-2-yl]carbamate |
| SMILES | CCCC(F)(F)[C@@H](CN)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H20F2N2O2/c1-2-8-14(15,16)12(9-17)18-13(19)20-10-11-6-4-3-5-7-11/h3-7,12H,2,8-10,17H2,1H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | KAIIOKLBSURGES-GFCCVEGCSA-N |
| XLogP | 2.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |