C19H18FNO5 — CID 103819682
5-(4-fluorophenyl)-4-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 103819682) has the molecular formula C19H18FNO5 and a molecular weight of 359.35 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-(4-fluorophenyl)-4-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 103819682 |
| Molecular Formula | C19H18FNO5 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 5-(4-fluorophenyl)-4-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | O=C(Cc1ccc(F)cc1)CC(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H18FNO5/c20-15-8-6-13(7-9-15)10-16(22)11-17(18(23)24)21-19(25)26-12-14-4-2-1-3-5-14/h1-9,17H,10-12H2,(H,21,25)(H,23,24) |
| InChIKey | NGZVOJPYRWOCGG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |