C11H12FNO5 — CID 143622592
methyl (2S)-2-(carbonofluoridoylamino)-3-(2,4-dihydroxyphenyl)propanoate (PubChem CID 143622592) has the molecular formula C11H12FNO5 and a molecular weight of 257.22 g/mol. Its IUPAC name is methyl (2S)-2-(carbonofluoridoylamino)-3-(2,4-dihydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-(carbonofluoridoylamino)-3-(2,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 143622592 |
| Molecular Formula | C11H12FNO5 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | methyl (2S)-2-(carbonofluoridoylamino)-3-(2,4-dihydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1O)NC(=O)F |
| InChI | InChI=1S/C11H12FNO5/c1-18-10(16)8(13-11(12)17)4-6-2-3-7(14)5-9(6)15/h2-3,5,8,14-15H,4H2,1H3,(H,13,17)/t8-/m0/s1 |
| InChIKey | WCYDEFLTBXXHJB-QMMMGPOBSA-N |
| XLogP | 0.86 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|