C14H17F4NO — CID 103289329
N-[1-cyclopropyl-2-(2,3,5,6-tetrafluorophenoxy)ethyl]propan-1-amine (PubChem CID 103289329) has the molecular formula C14H17F4NO and a molecular weight of 291.29 g/mol. Its IUPAC name is N-[1-cyclopropyl-2-(2,3,5,6-tetrafluorophenoxy)ethyl]propan-1-amine.
| Compound Name | N-[1-cyclopropyl-2-(2,3,5,6-tetrafluorophenoxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103289329 |
| Molecular Formula | C14H17F4NO |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-[1-cyclopropyl-2-(2,3,5,6-tetrafluorophenoxy)ethyl]propan-1-amine |
| SMILES | CCCNC(COc1c(F)c(F)cc(F)c1F)C1CC1 |
| InChI | InChI=1S/C14H17F4NO/c1-2-5-19-11(8-3-4-8)7-20-14-12(17)9(15)6-10(16)13(14)18/h6,8,11,19H,2-5,7H2,1H3 |
| InChIKey | PXUBFYFDTYDZFQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|