C17H25F2NO — CID 104748323
N-[1-cyclohexyl-2-(2,4-difluorophenoxy)ethyl]propan-1-amine (PubChem CID 104748323) has the molecular formula C17H25F2NO and a molecular weight of 297.39 g/mol. Its IUPAC name is N-[1-cyclohexyl-2-(2,4-difluorophenoxy)ethyl]propan-1-amine.
| Compound Name | N-[1-cyclohexyl-2-(2,4-difluorophenoxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 104748323 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | N-[1-cyclohexyl-2-(2,4-difluorophenoxy)ethyl]propan-1-amine |
| SMILES | CCCNC(COc1ccc(F)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C17H25F2NO/c1-2-10-20-16(13-6-4-3-5-7-13)12-21-17-9-8-14(18)11-15(17)19/h8-9,11,13,16,20H,2-7,10,12H2,1H3 |
| InChIKey | STUSIHYKAWEGPV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |