C12H12ClFN2O6 — CID 14912738
tert-butyl 2-chloro-2-(5-fluoro-2,4-dinitrophenyl)acetate (PubChem CID 14912738) has the molecular formula C12H12ClFN2O6 and a molecular weight of 334.69 g/mol. Its IUPAC name is tert-butyl 2-chloro-2-(5-fluoro-2,4-dinitrophenyl)acetate.
| Compound Name | tert-butyl 2-chloro-2-(5-fluoro-2,4-dinitrophenyl)acetate |
|---|---|
| PubChem CID | 14912738 |
| Molecular Formula | C12H12ClFN2O6 |
| Molecular Weight | 334.69 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | tert-butyl 2-chloro-2-(5-fluoro-2,4-dinitrophenyl)acetate |
| SMILES | CC(C)(C)OC(=O)C(Cl)c1cc(F)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12ClFN2O6/c1-12(2,3)22-11(17)10(13)6-4-7(14)9(16(20)21)5-8(6)15(18)19/h4-5,10H,1-3H3 |
| InChIKey | BDAQFZJBUXLCCR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|